About methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate
methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate (PubChem CID 56697865) has the molecular formula C10H16N2OS2
and a molecular weight of 244.38 g/mol. Its IUPAC name is methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate.
Molecular Properties
| Compound Name | methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate |
| PubChem CID | 56697865 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate |
| SMILES | CSC(=S)NNC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C10H16N2OS2/c1-10(2)5-7(4-8(13)6-10)11-12-9(14)15-3/h4,11H,5-6H2,1-3H3,(H,12,14) |
| InChIKey | YBAHQHHYKOIJBC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate?
The IUPAC name of methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate (CID 56697865) is methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate.
What is the SMILES notation for methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate?
The canonical SMILES for methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate is CSC(=S)NNC1=CC(=O)CC(C)(C)C1.
What is the InChIKey of methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate?
The InChIKey is YBAHQHHYKOIJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS2/c1-10(2)5-7(4-8(13)6-10)11-12-9(14)15-3/h4,11H,5-6H2,1-3H3,(H,12,14).
What are the key properties of methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate?
methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate has a molecular weight of 244.38 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamodithioate is sourced from PubChem (CID 56697865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).