About [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate
[3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate (PubChem CID 56697906) has the molecular formula C17H12INO2S2
and a molecular weight of 453.33 g/mol. Its IUPAC name is [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate.
Molecular Properties
| Compound Name | [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate |
| PubChem CID | 56697906 |
| Molecular Formula | C17H12INO2S2 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2csc(=S)n2-c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C17H12INO2S2/c1-11-3-2-4-12(9-11)16(20)21-15-10-23-17(22)19(15)14-7-5-13(18)6-8-14/h2-10H,1H3 |
| InChIKey | KAUBRVJKQGXVBF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate?
The IUPAC name of [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate (CID 56697906) is [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate.
What is the SMILES notation for [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate?
The canonical SMILES for [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate is Cc1cccc(C(=O)Oc2csc(=S)n2-c2ccc(I)cc2)c1.
What is the InChIKey of [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate?
The InChIKey is KAUBRVJKQGXVBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12INO2S2/c1-11-3-2-4-12(9-11)16(20)21-15-10-23-17(22)19(15)14-7-5-13(18)6-8-14/h2-10H,1H3.
What are the key properties of [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate?
[3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate has a molecular weight of 453.33 g/mol, XLogP of 5.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-iodophenyl)-2-sulfanylidene-1,3-thiazol-4-yl] 3-methylbenzoate is sourced from PubChem (CID 56697906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).