C28H26N2O5 — CID 56698215
[2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 56698215) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 56698215 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | CCC(C(=O)OC(C(=O)Nc1c(C)cccc1C)c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H26N2O5/c1-4-22(30-26(32)20-15-8-9-16-21(20)27(30)33)28(34)35-24(19-13-6-5-7-14-19)25(31)29-23-17(2)11-10-12-18(23)3/h5-16,22,24H,4H2,1-3H3,(H,29,31) |
| InChIKey | AUBHKFKKMCMCPW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|