C21H24N6O — CID 56699638
(4-ethylphenyl)-[4-[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 56699638) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | (4-ethylphenyl)-[4-[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56699638 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (4-ethylphenyl)-[4-[6-(2-methylimidazol-1-yl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(c3cc(-n4ccnc4C)ncn3)CC2)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-3-17-4-6-18(7-5-17)21(28)26-12-10-25(11-13-26)19-14-20(24-15-23-19)27-9-8-22-16(27)2/h4-9,14-15H,3,10-13H2,1-2H3 |
| InChIKey | YUZDVAKKDAPESD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |