C18H33N3O2 — CID 56700979
N-[1-[1-[2-(azepan-1-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]ethyl]-2-methoxyacetamide (PubChem CID 56700979) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is N-[1-[1-[2-(azepan-1-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]ethyl]-2-methoxyacetamide.
| Compound Name | N-[1-[1-[2-(azepan-1-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 56700979 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | N-[1-[1-[2-(azepan-1-yl)ethyl]-3,6-dihydro-2H-pyridin-5-yl]ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC(C)C1=CCCN(CCN2CCCCCC2)C1 |
| InChI | InChI=1S/C18H33N3O2/c1-16(19-18(22)15-23-2)17-8-7-11-21(14-17)13-12-20-9-5-3-4-6-10-20/h8,16H,3-7,9-15H2,1-2H3,(H,19,22) |
| InChIKey | UWCXUMGYRDXWQB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|