C18H30N4O2 — CID 56701117
2-(1-cyclopentylpiperidine-4-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one (PubChem CID 56701117) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(1-cyclopentylpiperidine-4-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 2-(1-cyclopentylpiperidine-4-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 56701117 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2-(1-cyclopentylpiperidine-4-carbonyl)-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
| SMILES | O=C1NCCN2CCN(C(=O)C3CCN(C4CCCC4)CC3)CC12 |
| InChI | InChI=1S/C18H30N4O2/c23-17-16-13-22(12-11-21(16)10-7-19-17)18(24)14-5-8-20(9-6-14)15-3-1-2-4-15/h14-16H,1-13H2,(H,19,23) |
| InChIKey | ZOESVOIGJQGIMQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |