C15H19N3O3 — CID 56701176
2-[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]-1H-pyridazine-3,6-dione (PubChem CID 56701176) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 56701176 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]-2-oxoethyl]-1H-pyridazine-3,6-dione |
| SMILES | C=CC[C@@H]1CC=C[C@@H](C)N1C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C15H19N3O3/c1-3-5-12-7-4-6-11(2)18(12)15(21)10-17-14(20)9-8-13(19)16-17/h3-4,6,8-9,11-12H,1,5,7,10H2,2H3,(H,16,19)/t11-,12-/m1/s1 |
| InChIKey | KXEWHOVYPHKTSN-VXGBXAGGSA-N |
| XLogP | 0.66 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|