C19H28N4 — CID 56701602
1-(1-ethylpiperidin-3-yl)-N-[(4-imidazol-1-ylphenyl)methyl]-N-methylmethanamine (PubChem CID 56701602) has the molecular formula C19H28N4 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-(1-ethylpiperidin-3-yl)-N-[(4-imidazol-1-ylphenyl)methyl]-N-methylmethanamine.
| Compound Name | 1-(1-ethylpiperidin-3-yl)-N-[(4-imidazol-1-ylphenyl)methyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 56701602 |
| Molecular Formula | C19H28N4 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 1-(1-ethylpiperidin-3-yl)-N-[(4-imidazol-1-ylphenyl)methyl]-N-methylmethanamine |
| SMILES | CCN1CCCC(CN(C)Cc2ccc(-n3ccnc3)cc2)C1 |
| InChI | InChI=1S/C19H28N4/c1-3-22-11-4-5-18(15-22)14-21(2)13-17-6-8-19(9-7-17)23-12-10-20-16-23/h6-10,12,16,18H,3-5,11,13-15H2,1-2H3 |
| InChIKey | XRIGDZOUGMEWIL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |