C18H20N4O — CID 56701762
1-[(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]piperidin-3-ol (PubChem CID 56701762) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-[(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]piperidin-3-ol.
| Compound Name | 1-[(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 56701762 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-[(3-phenylpyrazolo[1,5-a]pyrimidin-6-yl)methyl]piperidin-3-ol |
| SMILES | OC1CCCN(Cc2cnc3c(-c4ccccc4)cnn3c2)C1 |
| InChI | InChI=1S/C18H20N4O/c23-16-7-4-8-21(13-16)11-14-9-19-18-17(10-20-22(18)12-14)15-5-2-1-3-6-15/h1-3,5-6,9-10,12,16,23H,4,7-8,11,13H2 |
| InChIKey | YYOCFVDSMRRPNO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |