About 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine
3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine (PubChem CID 56702359) has the molecular formula C17H20ClN3O
and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine.
Molecular Properties
| Compound Name | 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine |
| PubChem CID | 56702359 |
| Molecular Formula | C17H20ClN3O |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c(Oc2ccc(CN3CCCC3)cc2Cl)n1 |
| InChI | InChI=1S/C17H20ClN3O/c1-12-10-19-13(2)17(20-12)22-16-6-5-14(9-15(16)18)11-21-7-3-4-8-21/h5-6,9-10H,3-4,7-8,11H2,1-2H3 |
| InChIKey | NVKISOYDQMNXOZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine?
The IUPAC name of 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine (CID 56702359) is 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine.
What is the SMILES notation for 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine?
The canonical SMILES for 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine is Cc1cnc(C)c(Oc2ccc(CN3CCCC3)cc2Cl)n1.
What is the InChIKey of 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine?
The InChIKey is NVKISOYDQMNXOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O/c1-12-10-19-13(2)17(20-12)22-16-6-5-14(9-15(16)18)11-21-7-3-4-8-21/h5-6,9-10H,3-4,7-8,11H2,1-2H3.
What are the key properties of 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine?
3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine has a molecular weight of 317.82 g/mol, XLogP of 4.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenoxy]-2,5-dimethylpyrazine is sourced from PubChem (CID 56702359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).