About 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide
2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide (PubChem CID 56702974) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide.
Molecular Properties
| Compound Name | 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide |
| PubChem CID | 56702974 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide |
| SMILES | C=CCN(CC1=CCCN(C)C1)C(=O)COC |
| InChI | InChI=1S/C13H22N2O2/c1-4-7-15(13(16)11-17-3)10-12-6-5-8-14(2)9-12/h4,6H,1,5,7-11H2,2-3H3 |
| InChIKey | GQJMDTAOXCMWQX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide?
The IUPAC name of 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide (CID 56702974) is 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide.
What is the SMILES notation for 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide?
The canonical SMILES for 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide is C=CCN(CC1=CCCN(C)C1)C(=O)COC.
What is the InChIKey of 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide?
The InChIKey is GQJMDTAOXCMWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-4-7-15(13(16)11-17-3)10-12-6-5-8-14(2)9-12/h4,6H,1,5,7-11H2,2-3H3.
What are the key properties of 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide?
2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide has a molecular weight of 238.33 g/mol, XLogP of 0.91, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[(1-methyl-3,6-dihydro-2H-pyridin-5-yl)methyl]-N-prop-2-enylacetamide is sourced from PubChem (CID 56702974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).