About 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole
3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole (PubChem CID 56703125) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole.
Molecular Properties
| Compound Name | 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole |
| PubChem CID | 56703125 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole |
| SMILES | Cn1cnnc1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H12N4/c1-16-8-14-15-12(16)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6H2,1H3 |
| InChIKey | CDEBIYLYPZHVMV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole?
The IUPAC name of 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole (CID 56703125) is 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole.
What is the SMILES notation for 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole?
The canonical SMILES for 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole is Cn1cnnc1Cc1c[nH]c2ccccc12.
What is the InChIKey of 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole?
The InChIKey is CDEBIYLYPZHVMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4/c1-16-8-14-15-12(16)6-9-7-13-11-5-3-2-4-10(9)11/h2-5,7-8,13H,6H2,1H3.
What are the key properties of 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole?
3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole has a molecular weight of 212.26 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,2,4-triazol-3-yl)methyl]-1H-indole is sourced from PubChem (CID 56703125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).