C20H25N5O — CID 56703501
4-(1,5-dimethylpyrazol-4-yl)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 56703501) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-(1,5-dimethylpyrazol-4-yl)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | 4-(1,5-dimethylpyrazol-4-yl)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 56703501 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 4-(1,5-dimethylpyrazol-4-yl)-5-(2-phenylmethoxyethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1c(C2c3nc[nH]c3CCN2CCOCc2ccccc2)cnn1C |
| InChI | InChI=1S/C20H25N5O/c1-15-17(12-23-24(15)2)20-19-18(21-14-22-19)8-9-25(20)10-11-26-13-16-6-4-3-5-7-16/h3-7,12,14,20H,8-11,13H2,1-2H3,(H,21,22) |
| InChIKey | IWECMWRDEPNZAL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|