C15H18N4O4S2 — CID 56703537
2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethylsulfamoyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid (PubChem CID 56703537) has the molecular formula C15H18N4O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethylsulfamoyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid.
| Compound Name | 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethylsulfamoyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 56703537 |
| Molecular Formula | C15H18N4O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethylsulfamoyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c(S(=O)(=O)NCc2n[nH]c3c2CCC3)sc2c1CCNC2 |
| InChI | InChI=1S/C15H18N4O4S2/c20-14(21)13-9-4-5-16-7-12(9)24-15(13)25(22,23)17-6-11-8-2-1-3-10(8)18-19-11/h16-17H,1-7H2,(H,18,19)(H,20,21) |
| InChIKey | YRYPDLITHRXOEW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |