C21H26N4 — CID 56705526
4-[[4-(3-propan-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinoline (PubChem CID 56705526) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 4-[[4-(3-propan-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinoline.
| Compound Name | 4-[[4-(3-propan-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinoline |
|---|---|
| PubChem CID | 56705526 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 4-[[4-(3-propan-2-yl-1H-pyrazol-5-yl)piperidin-1-yl]methyl]quinoline |
| SMILES | CC(C)c1cc(C2CCN(Cc3ccnc4ccccc34)CC2)[nH]n1 |
| InChI | InChI=1S/C21H26N4/c1-15(2)20-13-21(24-23-20)16-8-11-25(12-9-16)14-17-7-10-22-19-6-4-3-5-18(17)19/h3-7,10,13,15-16H,8-9,11-12,14H2,1-2H3,(H,23,24) |
| InChIKey | XRIQKACNMUSFNK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |