About 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol
2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol (PubChem CID 56705838) has the molecular formula C18H20N4O2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol |
| PubChem CID | 56705838 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol |
| SMILES | CN(Cc1ccc2cccc(O)c2n1)Cc1noc(C2CCC2)n1 |
| InChI | InChI=1S/C18H20N4O2/c1-22(11-16-20-18(24-21-16)13-5-2-6-13)10-14-9-8-12-4-3-7-15(23)17(12)19-14/h3-4,7-9,13,23H,2,5-6,10-11H2,1H3 |
| InChIKey | GQWQUDZMWODRCY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol?
The IUPAC name of 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol (CID 56705838) is 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol.
What is the SMILES notation for 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol?
The canonical SMILES for 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol is CN(Cc1ccc2cccc(O)c2n1)Cc1noc(C2CCC2)n1.
What is the InChIKey of 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol?
The InChIKey is GQWQUDZMWODRCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2/c1-22(11-16-20-18(24-21-16)13-5-2-6-13)10-14-9-8-12-4-3-7-15(23)17(12)19-14/h3-4,7-9,13,23H,2,5-6,10-11H2,1H3.
What are the key properties of 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol?
2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol has a molecular weight of 324.38 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-methylamino]methyl]quinolin-8-ol is sourced from PubChem (CID 56705838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).