C20H30N4O — CID 56705944
1-(4-methoxyphenyl)-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidin-4-amine (PubChem CID 56705944) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidin-4-amine.
| Compound Name | 1-(4-methoxyphenyl)-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 56705944 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[2-methyl-1-(1-methylimidazol-2-yl)propyl]piperidin-4-amine |
| SMILES | COc1ccc(N2CCC(NC(c3nccn3C)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30N4O/c1-15(2)19(20-21-11-14-23(20)3)22-16-9-12-24(13-10-16)17-5-7-18(25-4)8-6-17/h5-8,11,14-16,19,22H,9-10,12-13H2,1-4H3 |
| InChIKey | WMUYJAOADXYIIY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|