C20H22N4S — CID 567062
4,5-diphenyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 567062) has the molecular formula C20H22N4S and a molecular weight of 350.49 g/mol. Its IUPAC name is 4,5-diphenyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4,5-diphenyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 567062 |
| Molecular Formula | C20H22N4S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4,5-diphenyl-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCCCC2)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H22N4S/c25-20-23(16-22-14-8-3-9-15-22)21-19(17-10-4-1-5-11-17)24(20)18-12-6-2-7-13-18/h1-2,4-7,10-13H,3,8-9,14-16H2 |
| InChIKey | WCQYBGJFZCQXDB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|