C15H21N3O4S — CID 56706520
(2S,4R)-4-amino-N-ethyl-1-(4-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 56706520) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is (2S,4R)-4-amino-N-ethyl-1-(4-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-N-ethyl-1-(4-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56706520 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (2S,4R)-4-amino-N-ethyl-1-(4-methylsulfonylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1C[C@@H](N)CN1C(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-3-17-14(19)13-8-11(16)9-18(13)15(20)10-4-6-12(7-5-10)23(2,21)22/h4-7,11,13H,3,8-9,16H2,1-2H3,(H,17,19)/t11-,13+/m1/s1 |
| InChIKey | GQWVRIAPZIJIJP-YPMHNXCESA-N |
| XLogP | -0.23 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |