About 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol
3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol (PubChem CID 56706592) has the molecular formula C20H30N4O
and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol.
Molecular Properties
| Compound Name | 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol |
| PubChem CID | 56706592 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol |
| SMILES | Cc1cc(C)n(CC(C)NC2CCN(Cc3cccc(O)c3)CC2)n1 |
| InChI | InChI=1S/C20H30N4O/c1-15-11-17(3)24(22-15)13-16(2)21-19-7-9-23(10-8-19)14-18-5-4-6-20(25)12-18/h4-6,11-12,16,19,21,25H,7-10,13-14H2,1-3H3 |
| InChIKey | IEURXIJIITZCEL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol?
The IUPAC name of 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol (CID 56706592) is 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol.
What is the SMILES notation for 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol?
The canonical SMILES for 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol is Cc1cc(C)n(CC(C)NC2CCN(Cc3cccc(O)c3)CC2)n1.
What is the InChIKey of 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol?
The InChIKey is IEURXIJIITZCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O/c1-15-11-17(3)24(22-15)13-16(2)21-19-7-9-23(10-8-19)14-18-5-4-6-20(25)12-18/h4-6,11-12,16,19,21,25H,7-10,13-14H2,1-3H3.
What are the key properties of 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol?
3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol has a molecular weight of 342.49 g/mol, XLogP of 2.85, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]piperidin-1-yl]methyl]phenol is sourced from PubChem (CID 56706592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).