About 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol
4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol (PubChem CID 56706999) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol |
| PubChem CID | 56706999 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol |
| SMILES | COc1cc(-c2cccc3c2OC(CN)C3)ccc1O |
| InChI | InChI=1S/C16H17NO3/c1-19-15-8-10(5-6-14(15)18)13-4-2-3-11-7-12(9-17)20-16(11)13/h2-6,8,12,18H,7,9,17H2,1H3 |
| InChIKey | XBDSMXZOKLQBAT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol?
The IUPAC name of 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol (CID 56706999) is 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol.
What is the SMILES notation for 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol?
The canonical SMILES for 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol is COc1cc(-c2cccc3c2OC(CN)C3)ccc1O.
What is the InChIKey of 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol?
The InChIKey is XBDSMXZOKLQBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3/c1-19-15-8-10(5-6-14(15)18)13-4-2-3-11-7-12(9-17)20-16(11)13/h2-6,8,12,18H,7,9,17H2,1H3.
What are the key properties of 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol?
4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol has a molecular weight of 271.32 g/mol, XLogP of 2.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(aminomethyl)-2,3-dihydro-1-benzofuran-7-yl]-2-methoxyphenol is sourced from PubChem (CID 56706999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).