About 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol
2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol (PubChem CID 56707974) has the molecular formula C19H18ClF2N3O
and a molecular weight of 377.82 g/mol. Its IUPAC name is 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol.
Molecular Properties
| Compound Name | 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol |
| PubChem CID | 56707974 |
| Molecular Formula | C19H18ClF2N3O |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol |
| SMILES | Cc1c(C(C)NCc2ccc(O)c(Cl)c2)cnn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C19H18ClF2N3O/c1-11(23-9-13-3-6-19(26)16(20)7-13)15-10-24-25(12(15)2)18-5-4-14(21)8-17(18)22/h3-8,10-11,23,26H,9H2,1-2H3 |
| InChIKey | PCARLZZJTIKMPE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol?
The IUPAC name of 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol (CID 56707974) is 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol.
What is the SMILES notation for 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol?
The canonical SMILES for 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol is Cc1c(C(C)NCc2ccc(O)c(Cl)c2)cnn1-c1ccc(F)cc1F.
What is the InChIKey of 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol?
The InChIKey is PCARLZZJTIKMPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClF2N3O/c1-11(23-9-13-3-6-19(26)16(20)7-13)15-10-24-25(12(15)2)18-5-4-14(21)8-17(18)22/h3-8,10-11,23,26H,9H2,1-2H3.
What are the key properties of 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol?
2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol has a molecular weight of 377.82 g/mol, XLogP of 4.67, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[[1-[1-(2,4-difluorophenyl)-5-methylpyrazol-4-yl]ethylamino]methyl]phenol is sourced from PubChem (CID 56707974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).