About (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide
(3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide (PubChem CID 56708528) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide.
Molecular Properties
| Compound Name | (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide |
| PubChem CID | 56708528 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC[C@@H](c2ccc3ccccc3c2)[C@H](O)C1 |
| InChI | InChI=1S/C18H22N2O2/c1-19(2)18(22)20-10-9-16(17(21)12-20)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11,16-17,21H,9-10,12H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | CFCXAIJZPBQUHL-DLBZAZTESA-N |
| XLogP | 2.67 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide?
The IUPAC name of (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide (CID 56708528) is (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide.
What is the SMILES notation for (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide?
The canonical SMILES for (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide is CN(C)C(=O)N1CC[C@@H](c2ccc3ccccc3c2)[C@H](O)C1.
What is the InChIKey of (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide?
The InChIKey is CFCXAIJZPBQUHL-DLBZAZTESA-N. The full InChI is InChI=1S/C18H22N2O2/c1-19(2)18(22)20-10-9-16(17(21)12-20)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11,16-17,21H,9-10,12H2,1-2H3/t16-,17+/m0/s1.
What are the key properties of (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide?
(3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide has a molecular weight of 298.39 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-hydroxy-N,N-dimethyl-4-naphthalen-2-ylpiperidine-1-carboxamide is sourced from PubChem (CID 56708528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).