About (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide
(2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide (PubChem CID 56709986) has the molecular formula C12H23N3O4S
and a molecular weight of 305.40 g/mol. Its IUPAC name is (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide |
| PubChem CID | 56709986 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C[C@@H](N)CN1C(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C12H23N3O4S/c1-4-14(5-2)12(17)10-6-9(13)7-15(10)11(16)8-20(3,18)19/h9-10H,4-8,13H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | WAMYXCDJZLTCGG-ZJUUUORDSA-N |
| XLogP | -1.17 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide?
The IUPAC name of (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide (CID 56709986) is (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide?
The canonical SMILES for (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide is CCN(CC)C(=O)[C@@H]1C[C@@H](N)CN1C(=O)CS(C)(=O)=O.
What is the InChIKey of (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide?
The InChIKey is WAMYXCDJZLTCGG-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H23N3O4S/c1-4-14(5-2)12(17)10-6-9(13)7-15(10)11(16)8-20(3,18)19/h9-10H,4-8,13H2,1-3H3/t9-,10+/m1/s1.
What are the key properties of (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide?
(2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide has a molecular weight of 305.40 g/mol, XLogP of -1.17, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-amino-N,N-diethyl-1-(2-methylsulfonylacetyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 56709986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).