About 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one
3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one (PubChem CID 56710076) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one |
| PubChem CID | 56710076 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one |
| SMILES | CCc1noc(CN(CC)Cc2cc3cc(C)ccc3[nH]c2=O)n1 |
| InChI | InChI=1S/C18H22N4O2/c1-4-16-20-17(24-21-16)11-22(5-2)10-14-9-13-8-12(3)6-7-15(13)19-18(14)23/h6-9H,4-5,10-11H2,1-3H3,(H,19,23) |
| InChIKey | VLJYUBFDPVJSMP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one?
The IUPAC name of 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one (CID 56710076) is 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one.
What is the SMILES notation for 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one?
The canonical SMILES for 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one is CCc1noc(CN(CC)Cc2cc3cc(C)ccc3[nH]c2=O)n1.
What is the InChIKey of 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one?
The InChIKey is VLJYUBFDPVJSMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-4-16-20-17(24-21-16)11-22(5-2)10-14-9-13-8-12(3)6-7-15(13)19-18(14)23/h6-9H,4-5,10-11H2,1-3H3,(H,19,23).
What are the key properties of 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one?
3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one has a molecular weight of 326.40 g/mol, XLogP of 2.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[ethyl-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]amino]methyl]-6-methyl-1H-quinolin-2-one is sourced from PubChem (CID 56710076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).