C19H31N5O2 — CID 56710094
N-(3-hydroxypropyl)-1-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 56710094) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56710094 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | N-(3-hydroxypropyl)-1-(2-methyl-6-piperidin-4-ylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1nc(C2CCNCC2)cc(N2CCCC(C(=O)NCCCO)C2)n1 |
| InChI | InChI=1S/C19H31N5O2/c1-14-22-17(15-5-8-20-9-6-15)12-18(23-14)24-10-2-4-16(13-24)19(26)21-7-3-11-25/h12,15-16,20,25H,2-11,13H2,1H3,(H,21,26) |
| InChIKey | DREMAJOEQDMARM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|