C11H17F4N3O3 — CID 56710717
(2S,4R)-4-amino-N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]pyrrolidine-2-carboxamide (PubChem CID 56710717) has the molecular formula C11H17F4N3O3 and a molecular weight of 315.27 g/mol. Its IUPAC name is (2S,4R)-4-amino-N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-amino-N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56710717 |
| Molecular Formula | C11H17F4N3O3 |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2S,4R)-4-amino-N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](N)CN1C(=O)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H17F4N3O3/c1-17-9(20)7-2-6(16)3-18(7)8(19)4-21-5-11(14,15)10(12)13/h6-7,10H,2-5,16H2,1H3,(H,17,20)/t6-,7+/m1/s1 |
| InChIKey | HQMMPFZUTJKHQT-RQJHMYQMSA-N |
| XLogP | -0.42 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|