About 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one
5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 567112) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one.
Molecular Properties
| Compound Name | 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one |
| PubChem CID | 567112 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | COC1C(C)(C)CC(=O)C2OC21C |
| InChI | InChI=1S/C10H16O3/c1-9(2)5-6(11)7-10(3,13-7)8(9)12-4/h7-8H,5H2,1-4H3 |
| InChIKey | ORMHQBFCSMVJQW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one?
The IUPAC name of 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one (CID 567112) is 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one.
What is the SMILES notation for 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one?
The canonical SMILES for 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one is COC1C(C)(C)CC(=O)C2OC21C.
What is the InChIKey of 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one?
The InChIKey is ORMHQBFCSMVJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-9(2)5-6(11)7-10(3,13-7)8(9)12-4/h7-8H,5H2,1-4H3.
What are the key properties of 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one?
5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one has a molecular weight of 184.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-4,4,6-trimethyl-7-oxabicyclo[4.1.0]heptan-2-one is sourced from PubChem (CID 567112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).