C14H21NO4 — CID 567113
2'-butylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-isoindole]-1',3'-dione (PubChem CID 567113) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2'-butylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-isoindole]-1',3'-dione.
| Compound Name | 2'-butylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-isoindole]-1',3'-dione |
|---|---|
| PubChem CID | 567113 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2'-butylspiro[1,3-dioxolane-2,6'-4,5,7,7a-tetrahydro-3aH-isoindole]-1',3'-dione |
| SMILES | CCCCN1C(=O)C2CCC3(CC2C1=O)OCCO3 |
| InChI | InChI=1S/C14H21NO4/c1-2-3-6-15-12(16)10-4-5-14(18-7-8-19-14)9-11(10)13(15)17/h10-11H,2-9H2,1H3 |
| InChIKey | IZHNAPDZZOPIEK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|