C18H23N5OS — CID 56711429
N-methyl-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-[(2-pyrazol-1-ylphenyl)methyl]acetamide (PubChem CID 56711429) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is N-methyl-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-[(2-pyrazol-1-ylphenyl)methyl]acetamide.
| Compound Name | N-methyl-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-[(2-pyrazol-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 56711429 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-methyl-2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-N-[(2-pyrazol-1-ylphenyl)methyl]acetamide |
| SMILES | C[C@@H]1C[C@@H](CC(=O)N(C)Cc2ccccc2-n2cccn2)NC(=S)N1 |
| InChI | InChI=1S/C18H23N5OS/c1-13-10-15(21-18(25)20-13)11-17(24)22(2)12-14-6-3-4-7-16(14)23-9-5-8-19-23/h3-9,13,15H,10-12H2,1-2H3,(H2,20,21,25)/t13-,15+/m1/s1 |
| InChIKey | WFVMDDHHCYNUBB-HIFRSBDPSA-N |
| XLogP | 1.85 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|