C13H25N5 — CID 56712434
N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,2-dimethylpyrrolidin-3-amine (PubChem CID 56712434) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,2-dimethylpyrrolidin-3-amine.
| Compound Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,2-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 56712434 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2,2-dimethylpyrrolidin-3-amine |
| SMILES | Cc1nc(C)n(CCCNC2CCNC2(C)C)n1 |
| InChI | InChI=1S/C13H25N5/c1-10-16-11(2)18(17-10)9-5-7-14-12-6-8-15-13(12,3)4/h12,14-15H,5-9H2,1-4H3 |
| InChIKey | CIOZALULDRVSJI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|