C17H18N6 — CID 56712500
4-cyclohex-3-en-1-yl-1-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]triazole (PubChem CID 56712500) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-cyclohex-3-en-1-yl-1-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]triazole.
| Compound Name | 4-cyclohex-3-en-1-yl-1-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]triazole |
|---|---|
| PubChem CID | 56712500 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-cyclohex-3-en-1-yl-1-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]triazole |
| SMILES | C1=CCC(c2cn(Cc3nc(-c4ccccc4)n[nH]3)nn2)CC1 |
| InChI | InChI=1S/C17H18N6/c1-3-7-13(8-4-1)15-11-23(22-19-15)12-16-18-17(21-20-16)14-9-5-2-6-10-14/h1-3,5-6,9-11,13H,4,7-8,12H2,(H,18,20,21) |
| InChIKey | BRKIAZOSSAWXNC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|