About N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide
N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide (PubChem CID 56712616) has the molecular formula C13H19N7OS
and a molecular weight of 321.41 g/mol. Its IUPAC name is N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide |
| PubChem CID | 56712616 |
| Molecular Formula | C13H19N7OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nc(CNC(=O)c2cn(CC3CCCNC3)nn2)cs1 |
| InChI | InChI=1S/C13H19N7OS/c14-13-17-10(8-22-13)5-16-12(21)11-7-20(19-18-11)6-9-2-1-3-15-4-9/h7-9,15H,1-6H2,(H2,14,17)(H,16,21) |
| InChIKey | HUWXVNTWFRRGJK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide?
The IUPAC name of N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide (CID 56712616) is N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide.
What is the SMILES notation for N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide?
The canonical SMILES for N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide is Nc1nc(CNC(=O)c2cn(CC3CCCNC3)nn2)cs1.
What is the InChIKey of N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide?
The InChIKey is HUWXVNTWFRRGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N7OS/c14-13-17-10(8-22-13)5-16-12(21)11-7-20(19-18-11)6-9-2-1-3-15-4-9/h7-9,15H,1-6H2,(H2,14,17)(H,16,21).
What are the key properties of N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide?
N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide has a molecular weight of 321.41 g/mol, XLogP of 0.25, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-amino-1,3-thiazol-4-yl)methyl]-1-(piperidin-3-ylmethyl)triazole-4-carboxamide is sourced from PubChem (CID 56712616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).