C12H12FN3O3 — CID 56712753
[5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-fluorophenyl]methanol (PubChem CID 56712753) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is [5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-fluorophenyl]methanol.
| Compound Name | [5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-fluorophenyl]methanol |
|---|---|
| PubChem CID | 56712753 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [5-(4,6-dimethoxy-1,3,5-triazin-2-yl)-2-fluorophenyl]methanol |
| SMILES | COc1nc(OC)nc(-c2ccc(F)c(CO)c2)n1 |
| InChI | InChI=1S/C12H12FN3O3/c1-18-11-14-10(15-12(16-11)19-2)7-3-4-9(13)8(5-7)6-17/h3-5,17H,6H2,1-2H3 |
| InChIKey | WPZQWZWDOXNPNO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |