C22H25N3O — CID 56713290
(2S,4S)-4-amino-N-ethyl-1-[[2-(2-phenylethynyl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 56713290) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is (2S,4S)-4-amino-N-ethyl-1-[[2-(2-phenylethynyl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-N-ethyl-1-[[2-(2-phenylethynyl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56713290 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2S,4S)-4-amino-N-ethyl-1-[[2-(2-phenylethynyl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1C[C@H](N)CN1Cc1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C22H25N3O/c1-2-24-22(26)21-14-20(23)16-25(21)15-19-11-7-6-10-18(19)13-12-17-8-4-3-5-9-17/h3-11,20-21H,2,14-16,23H2,1H3,(H,24,26)/t20-,21-/m0/s1 |
| InChIKey | FEWHNFLVCMHDPG-SFTDATJTSA-N |
| XLogP | 2.12 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|