C16H22N4O3 — CID 56713311
4,6-dimethyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 56713311) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4,6-dimethyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4,6-dimethyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 56713311 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4,6-dimethyl-N-[3-(2-methyl-6-oxo-1-pyridinyl)propyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)NCCCn2c(C)cccc2=O)C(C)NC(=O)N1 |
| InChI | InChI=1S/C16H22N4O3/c1-10-6-4-7-13(21)20(10)9-5-8-17-15(22)14-11(2)18-16(23)19-12(14)3/h4,6-7,11H,5,8-9H2,1-3H3,(H,17,22)(H2,18,19,23) |
| InChIKey | QKQONQBSGCNWRV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|