C17H29N3O — CID 56714127
(2S,4S)-4-amino-N-ethyl-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 56714127) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S,4S)-4-amino-N-ethyl-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-N-ethyl-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 56714127 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | (2S,4S)-4-amino-N-ethyl-1-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | C=C(C)[C@@H]1CC=C(CN2C[C@@H](N)C[C@H]2C(=O)NCC)CC1 |
| InChI | InChI=1S/C17H29N3O/c1-4-19-17(21)16-9-15(18)11-20(16)10-13-5-7-14(8-6-13)12(2)3/h5,14-16H,2,4,6-11,18H2,1,3H3,(H,19,21)/t14-,15+,16+/m1/s1 |
| InChIKey | CBTZSCKJFLMNHB-PMPSAXMXSA-N |
| XLogP | 1.83 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|