About 1,2,4-triazole-3,4-diamine
1,2,4-triazole-3,4-diamine (PubChem CID 567144) has the molecular formula C2H5N5
and a molecular weight of 99.10 g/mol. Its IUPAC name is 1,2,4-triazole-3,4-diamine.
Molecular Properties
| Compound Name | 1,2,4-triazole-3,4-diamine |
| PubChem CID | 567144 |
| Molecular Formula | C2H5N5 |
| Molecular Weight | 99.10 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | 1,2,4-triazole-3,4-diamine |
| SMILES | Nc1nncn1N |
| InChI | InChI=1S/C2H5N5/c3-2-6-5-1-7(2)4/h1H,4H2,(H2,3,6) |
| InChIKey | VVICLQXCPOEFTM-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.10 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2,4-triazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-triazole-3,4-diamine?
The IUPAC name of 1,2,4-triazole-3,4-diamine (CID 567144) is 1,2,4-triazole-3,4-diamine.
What is the SMILES notation for 1,2,4-triazole-3,4-diamine?
The canonical SMILES for 1,2,4-triazole-3,4-diamine is Nc1nncn1N.
What is the InChIKey of 1,2,4-triazole-3,4-diamine?
The InChIKey is VVICLQXCPOEFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5/c3-2-6-5-1-7(2)4/h1H,4H2,(H2,3,6).
What are the key properties of 1,2,4-triazole-3,4-diamine?
1,2,4-triazole-3,4-diamine has a molecular weight of 99.10 g/mol, XLogP of -1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-triazole-3,4-diamine is sourced from PubChem (CID 567144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).