About 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine
4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine (PubChem CID 56714438) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine.
Molecular Properties
| Compound Name | 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine |
| PubChem CID | 56714438 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine |
| SMILES | c1ccc(-n2cnnc2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H20N4O/c1-2-5-14(6-3-1)19-13-16-17-15(19)7-4-8-18-9-11-20-12-10-18/h1-3,5-6,13H,4,7-12H2 |
| InChIKey | FGYINDLQNPBPDH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine?
The IUPAC name of 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine (CID 56714438) is 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine.
What is the SMILES notation for 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine?
The canonical SMILES for 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine is c1ccc(-n2cnnc2CCCN2CCOCC2)cc1.
What is the InChIKey of 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine?
The InChIKey is FGYINDLQNPBPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O/c1-2-5-14(6-3-1)19-13-16-17-15(19)7-4-8-18-9-11-20-12-10-18/h1-3,5-6,13H,4,7-12H2.
What are the key properties of 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine?
4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine has a molecular weight of 272.35 g/mol, XLogP of 1.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-phenyl-1,2,4-triazol-3-yl)propyl]morpholine is sourced from PubChem (CID 56714438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).