C15H27N5S — CID 56714735
N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-azaspiro[5.5]undecan-9-amine (PubChem CID 56714735) has the molecular formula C15H27N5S and a molecular weight of 309.48 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-azaspiro[5.5]undecan-9-amine.
| Compound Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-azaspiro[5.5]undecan-9-amine |
|---|---|
| PubChem CID | 56714735 |
| Molecular Formula | C15H27N5S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-3-azaspiro[5.5]undecan-9-amine |
| SMILES | Cc1nc(SCCNC2CCC3(CCNCC3)CC2)n[nH]1 |
| InChI | InChI=1S/C15H27N5S/c1-12-18-14(20-19-12)21-11-10-17-13-2-4-15(5-3-13)6-8-16-9-7-15/h13,16-17H,2-11H2,1H3,(H,18,19,20) |
| InChIKey | YRAKTIGXXIDBCJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|