C11H20O — CID 567148
2,6-diethyl-3,5-dimethyl-3,4-dihydro-2H-pyran (PubChem CID 567148) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 2,6-diethyl-3,5-dimethyl-3,4-dihydro-2H-pyran.
| Compound Name | 2,6-diethyl-3,5-dimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 567148 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 2,6-diethyl-3,5-dimethyl-3,4-dihydro-2H-pyran |
| SMILES | CCC1=C(C)CC(C)C(CC)O1 |
| InChI | InChI=1S/C11H20O/c1-5-10-8(3)7-9(4)11(6-2)12-10/h8,10H,5-7H2,1-4H3 |
| InChIKey | DCFJGGUMNKFZSD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |