About 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one
5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one (PubChem CID 567149) has the molecular formula C21H40O2
and a molecular weight of 324.55 g/mol. Its IUPAC name is 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one.
Molecular Properties
| Compound Name | 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one |
| PubChem CID | 567149 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)CCC(=O)O1 |
| InChI | InChI=1S/C21H40O2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-15-21(5)16-14-20(22)23-21/h17-19H,6-16H2,1-5H3 |
| InChIKey | LGWNRNDWDZHUNP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one?
The IUPAC name of 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one (CID 567149) is 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one.
What is the SMILES notation for 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one?
The canonical SMILES for 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one is CC(C)CCCC(C)CCCC(C)CCCC1(C)CCC(=O)O1.
What is the InChIKey of 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one?
The InChIKey is LGWNRNDWDZHUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-15-21(5)16-14-20(22)23-21/h17-19H,6-16H2,1-5H3.
What are the key properties of 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one?
5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one has a molecular weight of 324.55 g/mol, XLogP of 6.52, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-(4,8,12-trimethyltridecyl)oxolan-2-one is sourced from PubChem (CID 567149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).