C18H27FN2 — CID 56714946
N-[(4-fluoro-3-methylphenyl)methyl]-3-azaspiro[5.5]undecan-9-amine (PubChem CID 56714946) has the molecular formula C18H27FN2 and a molecular weight of 290.43 g/mol. Its IUPAC name is N-[(4-fluoro-3-methylphenyl)methyl]-3-azaspiro[5.5]undecan-9-amine.
| Compound Name | N-[(4-fluoro-3-methylphenyl)methyl]-3-azaspiro[5.5]undecan-9-amine |
|---|---|
| PubChem CID | 56714946 |
| Molecular Formula | C18H27FN2 |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | N-[(4-fluoro-3-methylphenyl)methyl]-3-azaspiro[5.5]undecan-9-amine |
| SMILES | Cc1cc(CNC2CCC3(CCNCC3)CC2)ccc1F |
| InChI | InChI=1S/C18H27FN2/c1-14-12-15(2-3-17(14)19)13-21-16-4-6-18(7-5-16)8-10-20-11-9-18/h2-3,12,16,20-21H,4-11,13H2,1H3 |
| InChIKey | RCWDWHJUNAYECB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |