About N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide
N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide (PubChem CID 56715243) has the molecular formula C17H28N2O2
and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide.
Molecular Properties
| Compound Name | N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide |
| PubChem CID | 56715243 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide |
| SMILES | CCCC(=O)NCC1CCCN(Cc2cc(C)c(C)o2)C1 |
| InChI | InChI=1S/C17H28N2O2/c1-4-6-17(20)18-10-15-7-5-8-19(11-15)12-16-9-13(2)14(3)21-16/h9,15H,4-8,10-12H2,1-3H3,(H,18,20) |
| InChIKey | MNAGZCAHGVOKDR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide?
The IUPAC name of N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide (CID 56715243) is N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide.
What is the SMILES notation for N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide?
The canonical SMILES for N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide is CCCC(=O)NCC1CCCN(Cc2cc(C)c(C)o2)C1.
What is the InChIKey of N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide?
The InChIKey is MNAGZCAHGVOKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O2/c1-4-6-17(20)18-10-15-7-5-8-19(11-15)12-16-9-13(2)14(3)21-16/h9,15H,4-8,10-12H2,1-3H3,(H,18,20).
What are the key properties of N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide?
N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide has a molecular weight of 292.42 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-[(4,5-dimethylfuran-2-yl)methyl]piperidin-3-yl]methyl]butanamide is sourced from PubChem (CID 56715243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).