C21H29N5O — CID 56715838
3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-N-(1-ethyltriazol-4-yl)benzamide (PubChem CID 56715838) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-N-(1-ethyltriazol-4-yl)benzamide.
| Compound Name | 3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-N-(1-ethyltriazol-4-yl)benzamide |
|---|---|
| PubChem CID | 56715838 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 3-[[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]methyl]-N-(1-ethyltriazol-4-yl)benzamide |
| SMILES | CCn1cc(NC(=O)c2cccc(CN3CC[C@@H]4CCCC[C@H]4C3)c2)nn1 |
| InChI | InChI=1S/C21H29N5O/c1-2-26-15-20(23-24-26)22-21(27)18-9-5-6-16(12-18)13-25-11-10-17-7-3-4-8-19(17)14-25/h5-6,9,12,15,17,19H,2-4,7-8,10-11,13-14H2,1H3,(H,22,27)/t17-,19-/m0/s1 |
| InChIKey | XYDGZLGNWZWAML-HKUYNNGSSA-N |
| XLogP | 3.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |