C11H14N4O2 — CID 56715993
[4-(2,5-dimethoxyphenyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 56715993) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is [4-(2,5-dimethoxyphenyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-(2,5-dimethoxyphenyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 56715993 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [4-(2,5-dimethoxyphenyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | COc1ccc(OC)c(-n2cnnc2CN)c1 |
| InChI | InChI=1S/C11H14N4O2/c1-16-8-3-4-10(17-2)9(5-8)15-7-13-14-11(15)6-12/h3-5,7H,6,12H2,1-2H3 |
| InChIKey | GXBSAAJQLAHINK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |