About S-butyl hexanethioate
S-butyl hexanethioate (PubChem CID 567160) has the molecular formula C10H20OS
and a molecular weight of 188.34 g/mol. Its IUPAC name is S-butyl hexanethioate.
Molecular Properties
| Compound Name | S-butyl hexanethioate |
| PubChem CID | 567160 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | S-butyl hexanethioate |
| SMILES | CCCCCC(=O)SCCCC |
| InChI | InChI=1S/C10H20OS/c1-3-5-7-8-10(11)12-9-6-4-2/h3-9H2,1-2H3 |
| InChIKey | FBORYKJGJUDLQA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-butyl hexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-butyl hexanethioate?
The IUPAC name of S-butyl hexanethioate (CID 567160) is S-butyl hexanethioate.
What is the SMILES notation for S-butyl hexanethioate?
The canonical SMILES for S-butyl hexanethioate is CCCCCC(=O)SCCCC.
What is the InChIKey of S-butyl hexanethioate?
The InChIKey is FBORYKJGJUDLQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OS/c1-3-5-7-8-10(11)12-9-6-4-2/h3-9H2,1-2H3.
What are the key properties of S-butyl hexanethioate?
S-butyl hexanethioate has a molecular weight of 188.34 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-butyl hexanethioate is sourced from PubChem (CID 567160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).