C23H25N3O4 — CID 56716362
3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one (PubChem CID 56716362) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one.
| Compound Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 56716362 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazine-1-carbonyl]-1-phenylpyrrolidin-2-one |
| SMILES | O=C(C1CCN(c2ccccc2)C1=O)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H25N3O4/c27-22(19-8-9-26(23(19)28)18-4-2-1-3-5-18)25-12-10-24(11-13-25)15-17-6-7-20-21(14-17)30-16-29-20/h1-7,14,19H,8-13,15-16H2 |
| InChIKey | DPQOAAXBZIDCMG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|