C22H28N4O — CID 56716428
[4-(5-methyl-2-pyridinyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-pyridin-4-ylmethanone (PubChem CID 56716428) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is [4-(5-methyl-2-pyridinyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-(5-methyl-2-pyridinyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 56716428 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | [4-(5-methyl-2-pyridinyl)-4-(pyrrolidin-1-ylmethyl)piperidin-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1ccc(C2(CN3CCCC3)CCN(C(=O)c3ccncc3)CC2)nc1 |
| InChI | InChI=1S/C22H28N4O/c1-18-4-5-20(24-16-18)22(17-25-12-2-3-13-25)8-14-26(15-9-22)21(27)19-6-10-23-11-7-19/h4-7,10-11,16H,2-3,8-9,12-15,17H2,1H3 |
| InChIKey | AHVCBQWANYNYLN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |