C17H27N5 — CID 56718473
1-(3,5-dimethylpyrazol-1-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)propan-2-amine (PubChem CID 56718473) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazol-1-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)propan-2-amine.
| Compound Name | 1-(3,5-dimethylpyrazol-1-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 56718473 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 1-(3,5-dimethylpyrazol-1-yl)-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)propan-2-amine |
| SMILES | Cc1cc(C)n(CC(C)NCc2n[nH]c3c2CCCCC3)n1 |
| InChI | InChI=1S/C17H27N5/c1-12-9-14(3)22(21-12)11-13(2)18-10-17-15-7-5-4-6-8-16(15)19-20-17/h9,13,18H,4-8,10-11H2,1-3H3,(H,19,20) |
| InChIKey | PKOPWEQGPXAZHN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |